About ethyl 2-(3,4-dichloroanilino)acetate
ethyl 2-(3,4-dichloroanilino)acetate (PubChem CID 2727804) has the molecular formula C10H11Cl2NO2
and a molecular weight of 248.11 g/mol. Its IUPAC name is ethyl 2-(3,4-dichloroanilino)acetate.
Molecular Properties
| Compound Name | ethyl 2-(3,4-dichloroanilino)acetate |
| PubChem CID | 2727804 |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | ethyl 2-(3,4-dichloroanilino)acetate |
| SMILES | CCOC(=O)CNc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO2/c1-2-15-10(14)6-13-7-3-4-8(11)9(12)5-7/h3-5,13H,2,6H2,1H3 |
| InChIKey | SQYQNTBOBNJCAD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(3,4-dichloroanilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3,4-dichloroanilino)acetate?
The IUPAC name of ethyl 2-(3,4-dichloroanilino)acetate (CID 2727804) is ethyl 2-(3,4-dichloroanilino)acetate.
What is the SMILES notation for ethyl 2-(3,4-dichloroanilino)acetate?
The canonical SMILES for ethyl 2-(3,4-dichloroanilino)acetate is CCOC(=O)CNc1ccc(Cl)c(Cl)c1.
What is the InChIKey of ethyl 2-(3,4-dichloroanilino)acetate?
The InChIKey is SQYQNTBOBNJCAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2NO2/c1-2-15-10(14)6-13-7-3-4-8(11)9(12)5-7/h3-5,13H,2,6H2,1H3.
What are the key properties of ethyl 2-(3,4-dichloroanilino)acetate?
ethyl 2-(3,4-dichloroanilino)acetate has a molecular weight of 248.11 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3,4-dichloroanilino)acetate is sourced from PubChem (CID 2727804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).