About methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate
methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 2727936) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate |
| PubChem CID | 2727936 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)Nc2[nH]ncc2C1c1ccccc1 |
| InChI | InChI=1S/C15H15N3O2/c1-9-12(15(19)20-2)13(10-6-4-3-5-7-10)11-8-16-18-14(11)17-9/h3-8,13H,1-2H3,(H2,16,17,18) |
| InChIKey | QBSQNUQNQCFCCQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate?
The IUPAC name of methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate (CID 2727936) is methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate.
What is the SMILES notation for methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate?
The canonical SMILES for methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate is COC(=O)C1=C(C)Nc2[nH]ncc2C1c1ccccc1.
What is the InChIKey of methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate?
The InChIKey is QBSQNUQNQCFCCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c1-9-12(15(19)20-2)13(10-6-4-3-5-7-10)11-8-16-18-14(11)17-9/h3-8,13H,1-2H3,(H2,16,17,18).
What are the key properties of methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate?
methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate has a molecular weight of 269.30 g/mol, XLogP of 2.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methyl-4-phenyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate is sourced from PubChem (CID 2727936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).