About 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine
6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine (PubChem CID 2727962) has the molecular formula C12H15ClN4
and a molecular weight of 250.73 g/mol. Its IUPAC name is 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine.
Molecular Properties
| Compound Name | 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine |
| PubChem CID | 2727962 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine |
| SMILES | CCNc1nc2ccc(Cl)cc2nc1NCC |
| InChI | InChI=1S/C12H15ClN4/c1-3-14-11-12(15-4-2)17-10-7-8(13)5-6-9(10)16-11/h5-7H,3-4H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | LYIMIPNCPHIVIA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine?
The IUPAC name of 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine (CID 2727962) is 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine.
What is the SMILES notation for 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine?
The canonical SMILES for 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine is CCNc1nc2ccc(Cl)cc2nc1NCC.
What is the InChIKey of 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine?
The InChIKey is LYIMIPNCPHIVIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN4/c1-3-14-11-12(15-4-2)17-10-7-8(13)5-6-9(10)16-11/h5-7H,3-4H2,1-2H3,(H,14,16)(H,15,17).
What are the key properties of 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine?
6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine has a molecular weight of 250.73 g/mol, XLogP of 3.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-N,3-N-diethylquinoxaline-2,3-diamine is sourced from PubChem (CID 2727962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).