About 2-but-3-enoxybenzamide
2-but-3-enoxybenzamide (PubChem CID 2728050) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-but-3-enoxybenzamide.
Molecular Properties
| Compound Name | 2-but-3-enoxybenzamide |
| PubChem CID | 2728050 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2-but-3-enoxybenzamide |
| SMILES | C=CCCOc1ccccc1C(N)=O |
| InChI | InChI=1S/C11H13NO2/c1-2-3-8-14-10-7-5-4-6-9(10)11(12)13/h2,4-7H,1,3,8H2,(H2,12,13) |
| InChIKey | DJSQREBRXVWWSD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-enoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-enoxybenzamide?
The IUPAC name of 2-but-3-enoxybenzamide (CID 2728050) is 2-but-3-enoxybenzamide.
What is the SMILES notation for 2-but-3-enoxybenzamide?
The canonical SMILES for 2-but-3-enoxybenzamide is C=CCCOc1ccccc1C(N)=O.
What is the InChIKey of 2-but-3-enoxybenzamide?
The InChIKey is DJSQREBRXVWWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-2-3-8-14-10-7-5-4-6-9(10)11(12)13/h2,4-7H,1,3,8H2,(H2,12,13).
What are the key properties of 2-but-3-enoxybenzamide?
2-but-3-enoxybenzamide has a molecular weight of 191.23 g/mol, XLogP of 1.74, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-enoxybenzamide is sourced from PubChem (CID 2728050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).