C15H13F3N2O2S — CID 2728154
2,2,2-trifluoro-N'-[2-(naphthalen-1-ylmethylsulfanyl)acetyl]acetohydrazide (PubChem CID 2728154) has the molecular formula C15H13F3N2O2S and a molecular weight of 342.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-[2-(naphthalen-1-ylmethylsulfanyl)acetyl]acetohydrazide.
| Compound Name | 2,2,2-trifluoro-N'-[2-(naphthalen-1-ylmethylsulfanyl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 2728154 |
| Molecular Formula | C15H13F3N2O2S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2,2,2-trifluoro-N'-[2-(naphthalen-1-ylmethylsulfanyl)acetyl]acetohydrazide |
| SMILES | O=C(CSCc1cccc2ccccc12)NNC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O2S/c16-15(17,18)14(22)20-19-13(21)9-23-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8-9H2,(H,19,21)(H,20,22) |
| InChIKey | AHONJARRZOIIEF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|