C26H31FN7O3+ — CID 27281672
ethyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]-(2-hydroxyethyl)azanium (PubChem CID 27281672) has the molecular formula C26H31FN7O3+ and a molecular weight of 508.58 g/mol. Its IUPAC name is ethyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]-(2-hydroxyethyl)azanium.
| Compound Name | ethyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 27281672 |
| Molecular Formula | C26H31FN7O3+ |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | ethyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]-(2-hydroxyethyl)azanium |
| SMILES | CC[NH+](CCO)CCCOc1ccc2c(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)ncnc2c1 |
| InChI | InChI=1S/C26H30FN7O3/c1-2-34(10-11-35)9-4-12-37-21-7-8-22-23(16-21)28-17-29-26(22)31-24-14-20(32-33-24)15-25(36)30-19-6-3-5-18(27)13-19/h3,5-8,13-14,16-17,35H,2,4,9-12,15H2,1H3,(H,30,36)(H2,28,29,31,32,33)/p+1 |
| InChIKey | QYZOGCMHVIGURT-UHFFFAOYSA-O |
| XLogP | 2.08 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|