C12H20NO4- — CID 27281685
(2S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylate (PubChem CID 27281685) has the molecular formula C12H20NO4- and a molecular weight of 242.29 g/mol. Its IUPAC name is (2S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylate.
| Compound Name | (2S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 27281685 |
| Molecular Formula | C12H20NO4- |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (2S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@@]1(C)C(=O)[O-] |
| InChI | InChI=1S/C12H21NO4/c1-11(2,3)17-10(16)13-8-6-5-7-12(13,4)9(14)15/h5-8H2,1-4H3,(H,14,15)/p-1/t12-/m0/s1 |
| InChIKey | BDAXXVZMKUJADB-LBPRGKRZSA-M |
| XLogP | 0.92 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |