About (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol
(E)-3-(3,5-difluorophenyl)prop-2-en-1-ol (PubChem CID 27282124) has the molecular formula C9H8F2O
and a molecular weight of 170.16 g/mol. Its IUPAC name is (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol |
| PubChem CID | 27282124 |
| Molecular Formula | C9H8F2O |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol |
| SMILES | OC/C=C/c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H8F2O/c10-8-4-7(2-1-3-12)5-9(11)6-8/h1-2,4-6,12H,3H2/b2-1+ |
| InChIKey | LTGHGWDPLZTILW-OWOJBTEDSA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol?
The IUPAC name of (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol (CID 27282124) is (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol.
What is the SMILES notation for (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol?
The canonical SMILES for (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol is OC/C=C/c1cc(F)cc(F)c1.
What is the InChIKey of (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol?
The InChIKey is LTGHGWDPLZTILW-OWOJBTEDSA-N. The full InChI is InChI=1S/C9H8F2O/c10-8-4-7(2-1-3-12)5-9(11)6-8/h1-2,4-6,12H,3H2/b2-1+.
What are the key properties of (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol?
(E)-3-(3,5-difluorophenyl)prop-2-en-1-ol has a molecular weight of 170.16 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3,5-difluorophenyl)prop-2-en-1-ol is sourced from PubChem (CID 27282124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).