About (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone
(9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone (PubChem CID 2728384) has the molecular formula C19H10FN3OS
and a molecular weight of 347.37 g/mol. Its IUPAC name is (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone |
| PubChem CID | 2728384 |
| Molecular Formula | C19H10FN3OS |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)n1c2ccc(F)cc2c2nc3ccccc3nc21 |
| InChI | InChI=1S/C19H10FN3OS/c20-11-7-8-15-12(10-11)17-18(22-14-5-2-1-4-13(14)21-17)23(15)19(24)16-6-3-9-25-16/h1-10H |
| InChIKey | DBYYEJLQEKMXSU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone?
The IUPAC name of (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone (CID 2728384) is (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone.
What is the SMILES notation for (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone?
The canonical SMILES for (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone is O=C(c1cccs1)n1c2ccc(F)cc2c2nc3ccccc3nc21.
What is the InChIKey of (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone?
The InChIKey is DBYYEJLQEKMXSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H10FN3OS/c20-11-7-8-15-12(10-11)17-18(22-14-5-2-1-4-13(14)21-17)23(15)19(24)16-6-3-9-25-16/h1-10H.
What are the key properties of (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone?
(9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone has a molecular weight of 347.37 g/mol, XLogP of 4.63, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (9-fluoroindolo[3,2-b]quinoxalin-6-yl)-thiophen-2-ylmethanone is sourced from PubChem (CID 2728384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).