2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid

C12H8N2O2S — CID 2728386

IUPAC2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid
SMILESO=C(O)c1ccc2nc(-n3cccc3)sc2c1
InChIInChI=1S/C12H8N2O2S/c15-11(16)8-3-4-9-10(7-8)17-12(13-9)14-5-1-2-6-14/h1-7H,(H,15,16)
InChIKeyDPZMSPMBTFFIAN-UHFFFAOYSA-N
MW244.28 g/mol
LogP2.79
Rot. Bonds2

About 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid

2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid (PubChem CID 2728386) has the molecular formula C12H8N2O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid.

Molecular Properties

Compound Name2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid
PubChem CID2728386
Molecular FormulaC12H8N2O2S
Molecular Weight244.28 g/mol
Exact Mass244.03
IUPAC Name2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid
SMILESO=C(O)c1ccc2nc(-n3cccc3)sc2c1
InChIInChI=1S/C12H8N2O2S/c15-11(16)8-3-4-9-10(7-8)17-12(13-9)14-5-1-2-6-14/h1-7H,(H,15,16)
InChIKeyDPZMSPMBTFFIAN-UHFFFAOYSA-N
XLogP2.79
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.28
LogP ≤ 52.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid?
The IUPAC name of 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid (CID 2728386) is 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid.
What is the SMILES notation for 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid?
The canonical SMILES for 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid is O=C(O)c1ccc2nc(-n3cccc3)sc2c1.
What is the InChIKey of 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid?
The InChIKey is DPZMSPMBTFFIAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2S/c15-11(16)8-3-4-9-10(7-8)17-12(13-9)14-5-1-2-6-14/h1-7H,(H,15,16).
What are the key properties of 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid?
2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid has a molecular weight of 244.28 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid is sourced from PubChem (CID 2728386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).