C12H8N2O2S — CID 2728386
2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid (PubChem CID 2728386) has the molecular formula C12H8N2O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 2728386 |
| Molecular Formula | C12H8N2O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(-n3cccc3)sc2c1 |
| InChI | InChI=1S/C12H8N2O2S/c15-11(16)8-3-4-9-10(7-8)17-12(13-9)14-5-1-2-6-14/h1-7H,(H,15,16) |
| InChIKey | DPZMSPMBTFFIAN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |