About 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol
2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol (PubChem CID 2728676) has the molecular formula C21H17NO2S
and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol.
Molecular Properties
| Compound Name | 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol |
| PubChem CID | 2728676 |
| Molecular Formula | C21H17NO2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol |
| SMILES | Oc1ccc(C2CC(c3ccccc3O)=Nc3ccccc3S2)cc1 |
| InChI | InChI=1S/C21H17NO2S/c23-15-11-9-14(10-12-15)21-13-18(16-5-1-3-7-19(16)24)22-17-6-2-4-8-20(17)25-21/h1-12,21,23-24H,13H2 |
| InChIKey | HYERRBRKDRGAKZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol?
The IUPAC name of 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol (CID 2728676) is 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol.
What is the SMILES notation for 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol?
The canonical SMILES for 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol is Oc1ccc(C2CC(c3ccccc3O)=Nc3ccccc3S2)cc1.
What is the InChIKey of 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol?
The InChIKey is HYERRBRKDRGAKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO2S/c23-15-11-9-14(10-12-15)21-13-18(16-5-1-3-7-19(16)24)22-17-6-2-4-8-20(17)25-21/h1-12,21,23-24H,13H2.
What are the key properties of 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol?
2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol has a molecular weight of 347.44 g/mol, XLogP of 5.46, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-hydroxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenol is sourced from PubChem (CID 2728676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).