C12H14O3 — CID 2728740
4,7,7-trimethyl-6,8-dihydrochromene-2,5-dione (PubChem CID 2728740) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 4,7,7-trimethyl-6,8-dihydrochromene-2,5-dione.
| Compound Name | 4,7,7-trimethyl-6,8-dihydrochromene-2,5-dione |
|---|---|
| PubChem CID | 2728740 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4,7,7-trimethyl-6,8-dihydrochromene-2,5-dione |
| SMILES | Cc1cc(=O)oc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C12H14O3/c1-7-4-10(14)15-9-6-12(2,3)5-8(13)11(7)9/h4H,5-6H2,1-3H3 |
| InChIKey | HJUGCIXWIAMGBH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |