C18H28N2O9S — CID 2728813
[(2S,3R,4R)-4-[(2R,4R)-3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate (PubChem CID 2728813) has the molecular formula C18H28N2O9S and a molecular weight of 448.49 g/mol. Its IUPAC name is [(2S,3R,4R)-4-[(2R,4R)-3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate.
| Compound Name | [(2S,3R,4R)-4-[(2R,4R)-3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate |
|---|---|
| PubChem CID | 2728813 |
| Molecular Formula | C18H28N2O9S |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [(2S,3R,4R)-4-[(2R,4R)-3-acetyl-4-(dimethylcarbamoyl)-1,3-thiazolidin-2-yl]-2,3-diacetyloxy-4-hydroxybutyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](O)[C@H]1SC[C@@H](C(=O)N(C)C)N1C(C)=O |
| InChI | InChI=1S/C18H28N2O9S/c1-9(21)20-13(17(26)19(5)6)8-30-18(20)15(25)16(29-12(4)24)14(28-11(3)23)7-27-10(2)22/h13-16,18,25H,7-8H2,1-6H3/t13-,14-,15+,16-,18+/m0/s1 |
| InChIKey | SUWBETGVJGEAJL-RNGZQALNSA-N |
| XLogP | -0.85 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|