C26H28N2O10 — CID 2728947
[(2R,3S,4R,5S)-2,4,5-triacetyloxy-1,6-dianilino-1,6-dioxohexan-3-yl] acetate (PubChem CID 2728947) has the molecular formula C26H28N2O10 and a molecular weight of 528.51 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-2,4,5-triacetyloxy-1,6-dianilino-1,6-dioxohexan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5S)-2,4,5-triacetyloxy-1,6-dianilino-1,6-dioxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 2728947 |
| Molecular Formula | C26H28N2O10 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | [(2R,3S,4R,5S)-2,4,5-triacetyloxy-1,6-dianilino-1,6-dioxohexan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]([C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)Nc1ccccc1)[C@H](OC(C)=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H28N2O10/c1-15(29)35-21(23(37-17(3)31)25(33)27-19-11-7-5-8-12-19)22(36-16(2)30)24(38-18(4)32)26(34)28-20-13-9-6-10-14-20/h5-14,21-24H,1-4H3,(H,27,33)(H,28,34)/t21-,22+,23+,24- |
| InChIKey | DMHHYGWGMPKKTF-NVPYSNMXSA-N |
| XLogP | 1.99 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|