C14H19ClN2O4 — CID 2729003
(2S)-2-amino-6-[(2-chlorophenyl)methoxycarbonylamino]hexanoic acid (PubChem CID 2729003) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is (2S)-2-amino-6-[(2-chlorophenyl)methoxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[(2-chlorophenyl)methoxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 2729003 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (2S)-2-amino-6-[(2-chlorophenyl)methoxycarbonylamino]hexanoic acid |
| SMILES | N[C@@H](CCCCNC(=O)OCc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C14H19ClN2O4/c15-11-6-2-1-5-10(11)9-21-14(20)17-8-4-3-7-12(16)13(18)19/h1-2,5-6,12H,3-4,7-9,16H2,(H,17,20)(H,18,19)/t12-/m0/s1 |
| InChIKey | YCQVFPIEKSYHFI-LBPRGKRZSA-N |
| XLogP | 2.15 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|