C18H21BrN2O3 — CID 27290331
(1R,4S)-N-[(Z)-1-(4-bromophenyl)ethylideneamino]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 27290331) has the molecular formula C18H21BrN2O3 and a molecular weight of 393.28 g/mol. Its IUPAC name is (1R,4S)-N-[(Z)-1-(4-bromophenyl)ethylideneamino]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,4S)-N-[(Z)-1-(4-bromophenyl)ethylideneamino]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 27290331 |
| Molecular Formula | C18H21BrN2O3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (1R,4S)-N-[(Z)-1-(4-bromophenyl)ethylideneamino]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | C/C(=N/NC(=O)[C@]12CC[C@](C)(C(=O)O1)C2(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H21BrN2O3/c1-11(12-5-7-13(19)8-6-12)20-21-14(22)18-10-9-17(4,15(23)24-18)16(18,2)3/h5-8H,9-10H2,1-4H3,(H,21,22)/b20-11-/t17-,18+/m1/s1 |
| InChIKey | QPPGSCFFVJPZOO-HIBAIMMXSA-N |
| XLogP | 3.41 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|