About methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate
methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate (PubChem CID 2729060) has the molecular formula C12H18O5
and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate.
Molecular Properties
| Compound Name | methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate |
| PubChem CID | 2729060 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate |
| SMILES | COC(=O)CCC1CC2(CCC1=O)OCCO2 |
| InChI | InChI=1S/C12H18O5/c1-15-11(14)3-2-9-8-12(5-4-10(9)13)16-6-7-17-12/h9H,2-8H2,1H3 |
| InChIKey | SFTQBDKZDPCZTN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate?
The IUPAC name of methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate (CID 2729060) is methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate.
What is the SMILES notation for methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate?
The canonical SMILES for methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate is COC(=O)CCC1CC2(CCC1=O)OCCO2.
What is the InChIKey of methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate?
The InChIKey is SFTQBDKZDPCZTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O5/c1-15-11(14)3-2-9-8-12(5-4-10(9)13)16-6-7-17-12/h9H,2-8H2,1H3.
What are the key properties of methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate?
methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate has a molecular weight of 242.27 g/mol, XLogP of 1.05, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate is sourced from PubChem (CID 2729060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).