methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate

C12H18O5 — CID 2729060

IUPACmethyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate
SMILESCOC(=O)CCC1CC2(CCC1=O)OCCO2
InChIInChI=1S/C12H18O5/c1-15-11(14)3-2-9-8-12(5-4-10(9)13)16-6-7-17-12/h9H,2-8H2,1H3
InChIKeySFTQBDKZDPCZTN-UHFFFAOYSA-N
MW242.27 g/mol
LogP1.05
Rot. Bonds3

About methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate

methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate (PubChem CID 2729060) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate
PubChem CID2729060
Molecular FormulaC12H18O5
Molecular Weight242.27 g/mol
Exact Mass242.12
IUPAC Namemethyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate
SMILESCOC(=O)CCC1CC2(CCC1=O)OCCO2
InChIInChI=1S/C12H18O5/c1-15-11(14)3-2-9-8-12(5-4-10(9)13)16-6-7-17-12/h9H,2-8H2,1H3
InChIKeySFTQBDKZDPCZTN-UHFFFAOYSA-N
XLogP1.05
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.27
LogP ≤ 51.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate?
The IUPAC name of methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate (CID 2729060) is methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate.
What is the SMILES notation for methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate?
The canonical SMILES for methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate is COC(=O)CCC1CC2(CCC1=O)OCCO2.
What is the InChIKey of methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate?
The InChIKey is SFTQBDKZDPCZTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O5/c1-15-11(14)3-2-9-8-12(5-4-10(9)13)16-6-7-17-12/h9H,2-8H2,1H3.
What are the key properties of methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate?
methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate has a molecular weight of 242.27 g/mol, XLogP of 1.05, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(8-oxo-1,4-dioxaspiro[4.5]decan-7-yl)propanoate is sourced from PubChem (CID 2729060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).