About 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole
5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole (PubChem CID 2729179) has the molecular formula C22H20N2
and a molecular weight of 312.42 g/mol. Its IUPAC name is 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole |
| PubChem CID | 2729179 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole |
| SMILES | Cc1ccc(C2=NN(c3ccccc3)C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H20N2/c1-17-12-14-18(15-13-17)21-16-22(19-8-4-2-5-9-19)24(23-21)20-10-6-3-7-11-20/h2-15,22H,16H2,1H3 |
| InChIKey | GDBZFBSFHRVCHG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole?
The IUPAC name of 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole (CID 2729179) is 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole.
What is the SMILES notation for 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole?
The canonical SMILES for 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole is Cc1ccc(C2=NN(c3ccccc3)C(c3ccccc3)C2)cc1.
What is the InChIKey of 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole?
The InChIKey is GDBZFBSFHRVCHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2/c1-17-12-14-18(15-13-17)21-16-22(19-8-4-2-5-9-19)24(23-21)20-10-6-3-7-11-20/h2-15,22H,16H2,1H3.
What are the key properties of 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole?
5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole has a molecular weight of 312.42 g/mol, XLogP of 5.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylphenyl)-2,3-diphenyl-3,4-dihydropyrazole is sourced from PubChem (CID 2729179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).