C25H25N5OS2 — CID 27292622
2-[(4-benzyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 27292622) has the molecular formula C25H25N5OS2 and a molecular weight of 475.64 g/mol. Its IUPAC name is 2-[(4-benzyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(4-benzyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 27292622 |
| Molecular Formula | C25H25N5OS2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-[(4-benzyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(CSc1nnc(-c2cccs2)n1Cc1ccccc1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C25H25N5OS2/c31-23(26-20-10-12-21(13-11-20)29-14-4-5-15-29)18-33-25-28-27-24(22-9-6-16-32-22)30(25)17-19-7-2-1-3-8-19/h1-3,6-13,16H,4-5,14-15,17-18H2,(H,26,31) |
| InChIKey | DSWAQTBSKFDTJO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|