About 3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol
3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol (PubChem CID 2729314) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol.
Analyze 3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol?
The IUPAC name of 3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol (CID 2729314) is 3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol.
What is the SMILES notation for 3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol?
The canonical SMILES for 3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol is CC1=NOC2(O)CC3C(C12)C3(C)C.
What is the InChIKey of 3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol?
The InChIKey is GZCUMBXVOIWKDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-5-7-8-6(9(8,2)3)4-10(7,12)13-11-5/h6-8,12H,4H2,1-3H3.
What are the key properties of 3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol?
3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol has a molecular weight of 181.23 g/mol, XLogP of 1.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,9-trimethyl-7-oxa-8-azatricyclo[4.3.0.02,4]non-8-en-6-ol is sourced from PubChem (CID 2729314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).