C16H20F6N2O3 — CID 2729327
butyl N-[1,1,1,3,3,3-hexafluoro-2-[(2-hydroxy-2-phenylethyl)amino]propan-2-yl]carbamate (PubChem CID 2729327) has the molecular formula C16H20F6N2O3 and a molecular weight of 402.34 g/mol. Its IUPAC name is butyl N-[1,1,1,3,3,3-hexafluoro-2-[(2-hydroxy-2-phenylethyl)amino]propan-2-yl]carbamate.
| Compound Name | butyl N-[1,1,1,3,3,3-hexafluoro-2-[(2-hydroxy-2-phenylethyl)amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 2729327 |
| Molecular Formula | C16H20F6N2O3 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | butyl N-[1,1,1,3,3,3-hexafluoro-2-[(2-hydroxy-2-phenylethyl)amino]propan-2-yl]carbamate |
| SMILES | CCCCOC(=O)NC(NCC(O)c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H20F6N2O3/c1-2-3-9-27-13(26)24-14(15(17,18)19,16(20,21)22)23-10-12(25)11-7-5-4-6-8-11/h4-8,12,23,25H,2-3,9-10H2,1H3,(H,24,26) |
| InChIKey | XWKRSPNZZZYOBC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|