C10H11F6N3O2S — CID 2729329
propan-2-yl N-[1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-ylamino)propan-2-yl]carbamate (PubChem CID 2729329) has the molecular formula C10H11F6N3O2S and a molecular weight of 351.27 g/mol. Its IUPAC name is propan-2-yl N-[1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-ylamino)propan-2-yl]carbamate.
| Compound Name | propan-2-yl N-[1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-ylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 2729329 |
| Molecular Formula | C10H11F6N3O2S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | propan-2-yl N-[1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-ylamino)propan-2-yl]carbamate |
| SMILES | CC(C)OC(=O)NC(Nc1nccs1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H11F6N3O2S/c1-5(2)21-7(20)19-8(9(11,12)13,10(14,15)16)18-6-17-3-4-22-6/h3-5H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | LSZMLOYCVWHYRY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|