C18H17F6N3O2 — CID 2729351
2-ethoxy-N-[1,1,1,3,3,3-hexafluoro-2-[(6-methyl-2-pyridinyl)amino]propan-2-yl]benzamide (PubChem CID 2729351) has the molecular formula C18H17F6N3O2 and a molecular weight of 421.34 g/mol. Its IUPAC name is 2-ethoxy-N-[1,1,1,3,3,3-hexafluoro-2-[(6-methyl-2-pyridinyl)amino]propan-2-yl]benzamide.
| Compound Name | 2-ethoxy-N-[1,1,1,3,3,3-hexafluoro-2-[(6-methyl-2-pyridinyl)amino]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 2729351 |
| Molecular Formula | C18H17F6N3O2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-ethoxy-N-[1,1,1,3,3,3-hexafluoro-2-[(6-methyl-2-pyridinyl)amino]propan-2-yl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NC(Nc1cccc(C)n1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H17F6N3O2/c1-3-29-13-9-5-4-8-12(13)15(28)27-16(17(19,20)21,18(22,23)24)26-14-10-6-7-11(2)25-14/h4-10H,3H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | BRYNXUPPQRGWJR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|