About 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea
3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea (PubChem CID 2729366) has the molecular formula C19H20ClN3OS
and a molecular weight of 373.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea |
| PubChem CID | 2729366 |
| Molecular Formula | C19H20ClN3OS |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea |
| SMILES | CC1CN=C(N(CCc2ccccc2)C(=O)Nc2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C19H20ClN3OS/c1-14-13-21-19(25-14)23(12-11-15-5-3-2-4-6-15)18(24)22-17-9-7-16(20)8-10-17/h2-10,14H,11-13H2,1H3,(H,22,24) |
| InChIKey | ZRKZAERFMHVWBX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea?
The IUPAC name of 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea (CID 2729366) is 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea.
What is the SMILES notation for 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea?
The canonical SMILES for 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea is CC1CN=C(N(CCc2ccccc2)C(=O)Nc2ccc(Cl)cc2)S1.
What is the InChIKey of 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea?
The InChIKey is ZRKZAERFMHVWBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClN3OS/c1-14-13-21-19(25-14)23(12-11-15-5-3-2-4-6-15)18(24)22-17-9-7-16(20)8-10-17/h2-10,14H,11-13H2,1H3,(H,22,24).
What are the key properties of 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea?
3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea has a molecular weight of 373.91 g/mol, XLogP of 4.91, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1-(2-phenylethyl)urea is sourced from PubChem (CID 2729366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).