C19H20F3N3O3 — CID 2729396
ethyl 3,3,3-trifluoro-2-[(3-methylbenzoyl)amino]-2-[(6-methyl-2-pyridinyl)amino]propanoate (PubChem CID 2729396) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-[(3-methylbenzoyl)amino]-2-[(6-methyl-2-pyridinyl)amino]propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-[(3-methylbenzoyl)amino]-2-[(6-methyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 2729396 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-[(3-methylbenzoyl)amino]-2-[(6-methyl-2-pyridinyl)amino]propanoate |
| SMILES | CCOC(=O)C(NC(=O)c1cccc(C)c1)(Nc1cccc(C)n1)C(F)(F)F |
| InChI | InChI=1S/C19H20F3N3O3/c1-4-28-17(27)18(19(20,21)22,24-15-10-6-8-13(3)23-15)25-16(26)14-9-5-7-12(2)11-14/h5-11H,4H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | OOZGOHDXNLRPJP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|