C23H25N3O4S — CID 27294254
(1-phenylpyrazol-4-yl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 27294254) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is (1-phenylpyrazol-4-yl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | (1-phenylpyrazol-4-yl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 27294254 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (1-phenylpyrazol-4-yl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(C(=O)OCc3cnn(-c4ccccc4)c3)cc2)CC1 |
| InChI | InChI=1S/C23H25N3O4S/c1-18-11-13-25(14-12-18)31(28,29)22-9-7-20(8-10-22)23(27)30-17-19-15-24-26(16-19)21-5-3-2-4-6-21/h2-10,15-16,18H,11-14,17H2,1H3 |
| InChIKey | QYGBVVMAHWRUOT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |