About 2-amino-5-benzyl-1,3-thiazol-4-one
2-amino-5-benzyl-1,3-thiazol-4-one (PubChem CID 2729442) has the molecular formula C10H10N2OS
and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-amino-5-benzyl-1,3-thiazol-4-one.
Molecular Properties
| Compound Name | 2-amino-5-benzyl-1,3-thiazol-4-one |
| PubChem CID | 2729442 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-amino-5-benzyl-1,3-thiazol-4-one |
| SMILES | NC1=NC(=O)C(Cc2ccccc2)S1 |
| InChI | InChI=1S/C10H10N2OS/c11-10-12-9(13)8(14-10)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,11,12,13) |
| InChIKey | ROFCBCGLJWSTNB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-5-benzyl-1,3-thiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-benzyl-1,3-thiazol-4-one?
The IUPAC name of 2-amino-5-benzyl-1,3-thiazol-4-one (CID 2729442) is 2-amino-5-benzyl-1,3-thiazol-4-one.
What is the SMILES notation for 2-amino-5-benzyl-1,3-thiazol-4-one?
The canonical SMILES for 2-amino-5-benzyl-1,3-thiazol-4-one is NC1=NC(=O)C(Cc2ccccc2)S1.
What is the InChIKey of 2-amino-5-benzyl-1,3-thiazol-4-one?
The InChIKey is ROFCBCGLJWSTNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2OS/c11-10-12-9(13)8(14-10)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,11,12,13).
What are the key properties of 2-amino-5-benzyl-1,3-thiazol-4-one?
2-amino-5-benzyl-1,3-thiazol-4-one has a molecular weight of 206.27 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-benzyl-1,3-thiazol-4-one is sourced from PubChem (CID 2729442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).