C20H22O6 — CID 2729489
2-methyl-5-[2-[2-[2-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)ethoxy]ethoxy]ethyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 2729489) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-methyl-5-[2-[2-[2-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)ethoxy]ethoxy]ethyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-methyl-5-[2-[2-[2-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)ethoxy]ethoxy]ethyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 2729489 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-methyl-5-[2-[2-[2-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)ethoxy]ethoxy]ethyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(CCOCCOCCC2=CC(=O)C(C)=CC2=O)=CC1=O |
| InChI | InChI=1S/C20H22O6/c1-13-9-19(23)15(11-17(13)21)3-5-25-7-8-26-6-4-16-12-18(22)14(2)10-20(16)24/h9-12H,3-8H2,1-2H3 |
| InChIKey | UZWAYAXDRBBHKE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|