C12H8N2O4 — CID 2729631
2,6-dimethylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 2729631) has the molecular formula C12H8N2O4 and a molecular weight of 244.21 g/mol. Its IUPAC name is 2,6-dimethylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-dimethylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 2729631 |
| Molecular Formula | C12H8N2O4 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2,6-dimethylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cn1c(=O)c2cc3c(=O)n(C)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C12H8N2O4/c1-13-9(15)5-3-7-8(4-6(5)10(13)16)12(18)14(2)11(7)17/h3-4H,1-2H3 |
| InChIKey | KFRQIZZPJFOLEH-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |