C22H29N3 — CID 2729700
1,15,15-trimethyl-10-(4-methylpiperazin-1-yl)-3-azatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene (PubChem CID 2729700) has the molecular formula C22H29N3 and a molecular weight of 335.50 g/mol. Its IUPAC name is 1,15,15-trimethyl-10-(4-methylpiperazin-1-yl)-3-azatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene.
| Compound Name | 1,15,15-trimethyl-10-(4-methylpiperazin-1-yl)-3-azatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 2729700 |
| Molecular Formula | C22H29N3 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 1,15,15-trimethyl-10-(4-methylpiperazin-1-yl)-3-azatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene |
| SMILES | CN1CCN(c2c3c(nc4ccccc24)C2(C)CCC3C2(C)C)CC1 |
| InChI | InChI=1S/C22H29N3/c1-21(2)16-9-10-22(21,3)20-18(16)19(25-13-11-24(4)12-14-25)15-7-5-6-8-17(15)23-20/h5-8,16H,9-14H2,1-4H3 |
| InChIKey | GRIFRVOZXAODGO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |