About 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile
2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile (PubChem CID 2729775) has the molecular formula C13H17ClN2
and a molecular weight of 236.75 g/mol. Its IUPAC name is 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile.
Molecular Properties
| Compound Name | 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile |
| PubChem CID | 2729775 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile |
| SMILES | CC(C)(C)C(C)(C#N)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2/c1-12(2,3)13(4,9-15)16-11-7-5-10(14)6-8-11/h5-8,16H,1-4H3 |
| InChIKey | RUFUBNZKPURVRF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile?
The IUPAC name of 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile (CID 2729775) is 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile.
What is the SMILES notation for 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile?
The canonical SMILES for 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile is CC(C)(C)C(C)(C#N)Nc1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile?
The InChIKey is RUFUBNZKPURVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2/c1-12(2,3)13(4,9-15)16-11-7-5-10(14)6-8-11/h5-8,16H,1-4H3.
What are the key properties of 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile?
2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile has a molecular weight of 236.75 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloroanilino)-2,3,3-trimethylbutanenitrile is sourced from PubChem (CID 2729775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).