C10H16N2 — CID 2729783
4,5,7-trimethyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine (PubChem CID 2729783) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 4,5,7-trimethyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine.
| Compound Name | 4,5,7-trimethyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 2729783 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 4,5,7-trimethyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine |
| SMILES | CC1CN(C)C(C)c2cc[nH]c21 |
| InChI | InChI=1S/C10H16N2/c1-7-6-12(3)8(2)9-4-5-11-10(7)9/h4-5,7-8,11H,6H2,1-3H3 |
| InChIKey | WVTOBSCFCZZSOE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |