About 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol
4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol (PubChem CID 2729786) has the molecular formula C25H26FNO
and a molecular weight of 375.49 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol |
| PubChem CID | 2729786 |
| Molecular Formula | C25H26FNO |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol |
| SMILES | CC1C(c2ccccc2)N(C)C(c2ccccc2)CC1(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FNO/c1-18-24(20-11-7-4-8-12-20)27(2)23(19-9-5-3-6-10-19)17-25(18,28)21-13-15-22(26)16-14-21/h3-16,18,23-24,28H,17H2,1-2H3 |
| InChIKey | NTQGEZJOMVFLMK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol?
The IUPAC name of 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol (CID 2729786) is 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol.
What is the SMILES notation for 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol?
The canonical SMILES for 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol is CC1C(c2ccccc2)N(C)C(c2ccccc2)CC1(O)c1ccc(F)cc1.
What is the InChIKey of 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol?
The InChIKey is NTQGEZJOMVFLMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26FNO/c1-18-24(20-11-7-4-8-12-20)27(2)23(19-9-5-3-6-10-19)17-25(18,28)21-13-15-22(26)16-14-21/h3-16,18,23-24,28H,17H2,1-2H3.
What are the key properties of 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol?
4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol has a molecular weight of 375.49 g/mol, XLogP of 5.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-1,3-dimethyl-2,6-diphenylpiperidin-4-ol is sourced from PubChem (CID 2729786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).