C18H22ClNO — CID 2729799
3-methyl-2,6-diphenylpiperidin-4-ol;hydrochloride (PubChem CID 2729799) has the molecular formula C18H22ClNO and a molecular weight of 303.83 g/mol. Its IUPAC name is 3-methyl-2,6-diphenylpiperidin-4-ol;hydrochloride.
| Compound Name | 3-methyl-2,6-diphenylpiperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 2729799 |
| Molecular Formula | C18H22ClNO |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-methyl-2,6-diphenylpiperidin-4-ol;hydrochloride |
| SMILES | CC1C(O)CC(c2ccccc2)NC1c1ccccc1.Cl |
| InChI | InChI=1S/C18H21NO.ClH/c1-13-17(20)12-16(14-8-4-2-5-9-14)19-18(13)15-10-6-3-7-11-15;/h2-11,13,16-20H,12H2,1H3;1H |
| InChIKey | KDVJYIGUCMROAP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |