C12H16F3N3O4S — CID 2729812
ethyl 3,3,3-trifluoro-2-(propoxycarbonylamino)-2-(1,3-thiazol-2-ylamino)propanoate (PubChem CID 2729812) has the molecular formula C12H16F3N3O4S and a molecular weight of 355.34 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-(propoxycarbonylamino)-2-(1,3-thiazol-2-ylamino)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-(propoxycarbonylamino)-2-(1,3-thiazol-2-ylamino)propanoate |
|---|---|
| PubChem CID | 2729812 |
| Molecular Formula | C12H16F3N3O4S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-(propoxycarbonylamino)-2-(1,3-thiazol-2-ylamino)propanoate |
| SMILES | CCCOC(=O)NC(Nc1nccs1)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O4S/c1-3-6-22-10(20)18-11(12(13,14)15,8(19)21-4-2)17-9-16-5-7-23-9/h5,7H,3-4,6H2,1-2H3,(H,16,17)(H,18,20) |
| InChIKey | IWDXMTIYHYXRBA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|