C9H8Cl2N2S — CID 2729997
N-(3,5-dichlorophenyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 2729997) has the molecular formula C9H8Cl2N2S and a molecular weight of 247.15 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(3,5-dichlorophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2729997 |
| Molecular Formula | C9H8Cl2N2S |
| Molecular Weight | 247.15 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | Clc1cc(Cl)cc(NC2=NCCS2)c1 |
| InChI | InChI=1S/C9H8Cl2N2S/c10-6-3-7(11)5-8(4-6)13-9-12-1-2-14-9/h3-5H,1-2H2,(H,12,13) |
| InChIKey | HXENQTNLXPSEFJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.15 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |