About [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate
[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate (PubChem CID 2730053) has the molecular formula C17H12Cl2N2O3S
and a molecular weight of 395.27 g/mol. Its IUPAC name is [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate.
Molecular Properties
| Compound Name | [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate |
| PubChem CID | 2730053 |
| Molecular Formula | C17H12Cl2N2O3S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate |
| SMILES | Cc1cc(OC(=O)c2ccco2)nc(SCc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C17H12Cl2N2O3S/c1-10-8-15(24-16(22)14-6-3-7-23-14)21-17(20-10)25-9-11-12(18)4-2-5-13(11)19/h2-8H,9H2,1H3 |
| InChIKey | LQLMQIDTZGWDNJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate?
The IUPAC name of [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate (CID 2730053) is [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate.
What is the SMILES notation for [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate?
The canonical SMILES for [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate is Cc1cc(OC(=O)c2ccco2)nc(SCc2c(Cl)cccc2Cl)n1.
What is the InChIKey of [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate?
The InChIKey is LQLMQIDTZGWDNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2N2O3S/c1-10-8-15(24-16(22)14-6-3-7-23-14)21-17(20-10)25-9-11-12(18)4-2-5-13(11)19/h2-8H,9H2,1H3.
What are the key properties of [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate?
[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate has a molecular weight of 395.27 g/mol, XLogP of 5.20, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl] furan-2-carboxylate is sourced from PubChem (CID 2730053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).