C12H18N6O2 — CID 2730056
N-(4-acetamido-6-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide (PubChem CID 2730056) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is N-(4-acetamido-6-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide.
| Compound Name | N-(4-acetamido-6-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide |
|---|---|
| PubChem CID | 2730056 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-(4-acetamido-6-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide |
| SMILES | CC(=O)Nc1nc(NC(C)=O)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C12H18N6O2/c1-8(19)13-10-15-11(14-9(2)20)17-12(16-10)18-6-4-3-5-7-18/h3-7H2,1-2H3,(H2,13,14,15,16,17,19,20) |
| InChIKey | BGVOFXKXVZGAMO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |