C14H13Cl2N3S — CID 2730107
1-(3,5-dichlorophenyl)-3-(2-pyridin-2-ylethyl)thiourea (PubChem CID 2730107) has the molecular formula C14H13Cl2N3S and a molecular weight of 326.25 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(2-pyridin-2-ylethyl)thiourea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(2-pyridin-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 2730107 |
| Molecular Formula | C14H13Cl2N3S |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(2-pyridin-2-ylethyl)thiourea |
| SMILES | S=C(NCCc1ccccn1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2N3S/c15-10-7-11(16)9-13(8-10)19-14(20)18-6-4-12-3-1-2-5-17-12/h1-3,5,7-9H,4,6H2,(H2,18,19,20) |
| InChIKey | SNTBZWHAVYFUDL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|