About N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide
N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide (PubChem CID 2730126) has the molecular formula C18H26IN3OS
and a molecular weight of 459.40 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide.
Molecular Properties
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide |
| PubChem CID | 2730126 |
| Molecular Formula | C18H26IN3OS |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide |
| SMILES | CC[n+]1c(C)csc1Nc1ccc(N2CC(C)OC(C)C2)cc1.[I-] |
| InChI | InChI=1S/C18H25N3OS.HI/c1-5-21-13(2)12-23-18(21)19-16-6-8-17(9-7-16)20-10-14(3)22-15(4)11-20;/h6-9,12,14-15H,5,10-11H2,1-4H3;1H |
| InChIKey | GXNTZMLLLSAZLC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 28.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide?
The IUPAC name of N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide (CID 2730126) is N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide.
What is the SMILES notation for N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide?
The canonical SMILES for N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide is CC[n+]1c(C)csc1Nc1ccc(N2CC(C)OC(C)C2)cc1.[I-].
What is the InChIKey of N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide?
The InChIKey is GXNTZMLLLSAZLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3OS.HI/c1-5-21-13(2)12-23-18(21)19-16-6-8-17(9-7-16)20-10-14(3)22-15(4)11-20;/h6-9,12,14-15H,5,10-11H2,1-4H3;1H.
What are the key properties of N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide?
N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide has a molecular weight of 459.40 g/mol, XLogP of 0.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine iodide is sourced from PubChem (CID 2730126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).