C10H15N5 — CID 2730206
1-(diaminomethylidene)-2-(2,3-dimethylphenyl)guanidine (PubChem CID 2730206) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(2,3-dimethylphenyl)guanidine.
| Compound Name | 1-(diaminomethylidene)-2-(2,3-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 2730206 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-(diaminomethylidene)-2-(2,3-dimethylphenyl)guanidine |
| SMILES | Cc1cccc(/N=C(\N)N=C(N)N)c1C |
| InChI | InChI=1S/C10H15N5/c1-6-4-3-5-8(7(6)2)14-10(13)15-9(11)12/h3-5H,1-2H3,(H6,11,12,13,14,15) |
| InChIKey | QPUAWEXLLDSJBV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|