C12H15N5O3 — CID 2730220
2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 2730220) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 2730220 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cc(Nc2ncnc(N)n2)cc(OC)c1OC |
| InChI | InChI=1S/C12H15N5O3/c1-18-8-4-7(5-9(19-2)10(8)20-3)16-12-15-6-14-11(13)17-12/h4-6H,1-3H3,(H3,13,14,15,16,17) |
| InChIKey | XUXJDRHHZUDWRS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |