C26H29FN2O6 — CID 27302447
methyl 4-[(2R)-1-[2-(diethylamino)ethyl]-3-[(3-fluoro-4-methoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 27302447) has the molecular formula C26H29FN2O6 and a molecular weight of 484.52 g/mol. Its IUPAC name is methyl 4-[(2R)-1-[2-(diethylamino)ethyl]-3-[(3-fluoro-4-methoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2R)-1-[2-(diethylamino)ethyl]-3-[(3-fluoro-4-methoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 27302447 |
| Molecular Formula | C26H29FN2O6 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | methyl 4-[(2R)-1-[2-(diethylamino)ethyl]-3-[(3-fluoro-4-methoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | CCN(CC)CCN1C(=O)C(=O)C(=C(O)c2ccc(OC)c(F)c2)[C@H]1c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C26H29FN2O6/c1-5-28(6-2)13-14-29-22(16-7-9-17(10-8-16)26(33)35-4)21(24(31)25(29)32)23(30)18-11-12-20(34-3)19(27)15-18/h7-12,15,22,30H,5-6,13-14H2,1-4H3/t22-/m1/s1 |
| InChIKey | JIMISTUCSYPSRY-JOCHJYFZSA-N |
| XLogP | 3.38 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|