About 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine
1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine (PubChem CID 2730277) has the molecular formula C5H8N6S
and a molecular weight of 184.23 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine.
Molecular Properties
| Compound Name | 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine |
| PubChem CID | 2730277 |
| Molecular Formula | C5H8N6S |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine |
| SMILES | NC(N)=NC(N)=Nc1nccs1 |
| InChI | InChI=1S/C5H8N6S/c6-3(7)10-4(8)11-5-9-1-2-12-5/h1-2H,(H6,6,7,8,9,10,11) |
| InChIKey | QYTORGOOJMNRFB-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine?
The IUPAC name of 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine (CID 2730277) is 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine.
What is the SMILES notation for 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine?
The canonical SMILES for 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine is NC(N)=NC(N)=Nc1nccs1.
What is the InChIKey of 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine?
The InChIKey is QYTORGOOJMNRFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N6S/c6-3(7)10-4(8)11-5-9-1-2-12-5/h1-2H,(H6,6,7,8,9,10,11).
What are the key properties of 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine?
1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine has a molecular weight of 184.23 g/mol, XLogP of -0.64, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diaminomethylidene)-2-(1,3-thiazol-2-yl)guanidine is sourced from PubChem (CID 2730277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).