C15H12ClN5O — CID 2730286
2-N-[4-(4-chlorophenoxy)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 2730286) has the molecular formula C15H12ClN5O and a molecular weight of 313.75 g/mol. Its IUPAC name is 2-N-[4-(4-chlorophenoxy)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[4-(4-chlorophenoxy)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 2730286 |
| Molecular Formula | C15H12ClN5O |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-N-[4-(4-chlorophenoxy)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1ncnc(Nc2ccc(Oc3ccc(Cl)cc3)cc2)n1 |
| InChI | InChI=1S/C15H12ClN5O/c16-10-1-5-12(6-2-10)22-13-7-3-11(4-8-13)20-15-19-9-18-14(17)21-15/h1-9H,(H3,17,18,19,20,21) |
| InChIKey | JSPXITPXMRLRIW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |