C13H9Cl2N5 — CID 2730357
N-(3,5-dichlorophenyl)-4-pyrrol-1-yl-1,3,5-triazin-2-amine (PubChem CID 2730357) has the molecular formula C13H9Cl2N5 and a molecular weight of 306.16 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-pyrrol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(3,5-dichlorophenyl)-4-pyrrol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 2730357 |
| Molecular Formula | C13H9Cl2N5 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-pyrrol-1-yl-1,3,5-triazin-2-amine |
| SMILES | Clc1cc(Cl)cc(Nc2ncnc(-n3cccc3)n2)c1 |
| InChI | InChI=1S/C13H9Cl2N5/c14-9-5-10(15)7-11(6-9)18-12-16-8-17-13(19-12)20-3-1-2-4-20/h1-8H,(H,16,17,18,19) |
| InChIKey | VLFHXTUERUHJPB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |