About 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone
2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone (PubChem CID 2730358) has the molecular formula C17H9ClF6N4O
and a molecular weight of 434.73 g/mol. Its IUPAC name is 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone.
Molecular Properties
| Compound Name | 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone |
| PubChem CID | 2730358 |
| Molecular Formula | C17H9ClF6N4O |
| Molecular Weight | 434.73 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone |
| SMILES | O=C(Cn1nnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H9ClF6N4O/c18-13-3-1-9(2-4-13)14(29)8-28-26-15(25-27-28)10-5-11(16(19,20)21)7-12(6-10)17(22,23)24/h1-7H,8H2 |
| InChIKey | RAEZCHZTSTVIIU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.73 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone?
The IUPAC name of 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone (CID 2730358) is 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone.
What is the SMILES notation for 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone?
The canonical SMILES for 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone is O=C(Cn1nnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1ccc(Cl)cc1.
What is the InChIKey of 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone?
The InChIKey is RAEZCHZTSTVIIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClF6N4O/c18-13-3-1-9(2-4-13)14(29)8-28-26-15(25-27-28)10-5-11(16(19,20)21)7-12(6-10)17(22,23)24/h1-7H,8H2.
What are the key properties of 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone?
2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone has a molecular weight of 434.73 g/mol, XLogP of 4.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]-1-(4-chlorophenyl)ethanone is sourced from PubChem (CID 2730358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).