About 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide
2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide (PubChem CID 2730382) has the molecular formula C11H8F6N6O
and a molecular weight of 354.21 g/mol. Its IUPAC name is 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide.
Molecular Properties
| Compound Name | 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide |
| PubChem CID | 2730382 |
| Molecular Formula | C11H8F6N6O |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide |
| SMILES | NNC(=O)Cn1nnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C11H8F6N6O/c12-10(13,14)6-1-5(2-7(3-6)11(15,16)17)9-20-22-23(21-9)4-8(24)19-18/h1-3H,4,18H2,(H,19,24) |
| InChIKey | SLBFHYAKGTZAML-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide?
The IUPAC name of 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide (CID 2730382) is 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide.
What is the SMILES notation for 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide?
The canonical SMILES for 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide is NNC(=O)Cn1nnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1.
What is the InChIKey of 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide?
The InChIKey is SLBFHYAKGTZAML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F6N6O/c12-10(13,14)6-1-5(2-7(3-6)11(15,16)17)9-20-22-23(21-9)4-8(24)19-18/h1-3H,4,18H2,(H,19,24).
What are the key properties of 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide?
2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide has a molecular weight of 354.21 g/mol, XLogP of 1.37, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]acetohydrazide is sourced from PubChem (CID 2730382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).