About 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole
5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole (PubChem CID 2730408) has the molecular formula C12H6F6N4
and a molecular weight of 320.20 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole.
Molecular Properties
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole |
| PubChem CID | 2730408 |
| Molecular Formula | C12H6F6N4 |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole |
| SMILES | C#CCn1nnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C12H6F6N4/c1-2-3-22-20-10(19-21-22)7-4-8(11(13,14)15)6-9(5-7)12(16,17)18/h1,4-6H,3H2 |
| InChIKey | AEPDLSOWNCWVSK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole?
The IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole (CID 2730408) is 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole.
What is the SMILES notation for 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole?
The canonical SMILES for 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole is C#CCn1nnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1.
What is the InChIKey of 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole?
The InChIKey is AEPDLSOWNCWVSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6F6N4/c1-2-3-22-20-10(19-21-22)7-4-8(11(13,14)15)6-9(5-7)12(16,17)18/h1,4-6H,3H2.
What are the key properties of 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole?
5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole has a molecular weight of 320.20 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(trifluoromethyl)phenyl]-2-prop-2-ynyltetrazole is sourced from PubChem (CID 2730408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).