C28H27NO3 — CID 27304865
(5S)-1-benzyl-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione (PubChem CID 27304865) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is (5S)-1-benzyl-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-1-benzyl-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 27304865 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (5S)-1-benzyl-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C(O)=C2C(=O)C(=O)N(Cc3ccccc3)[C@H]2c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H27NO3/c1-18(2)21-13-15-22(16-14-21)25-24(26(30)23-11-9-19(3)10-12-23)27(31)28(32)29(25)17-20-7-5-4-6-8-20/h4-16,18,25,30H,17H2,1-3H3/t25-/m0/s1 |
| InChIKey | DQKQQBXOALQRPM-VWLOTQADSA-N |
| XLogP | 5.74 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|